C18H32N4O5 — CID 143678940
3-(2,5-dioxopyrrol-1-yl)-N-(3-methylbutyl)propanamide;4-hydroxy-2,2-dimethylbutanehydrazide (PubChem CID 143678940) has the molecular formula C18H32N4O5 and a molecular weight of 384.48 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-(3-methylbutyl)propanamide;4-hydroxy-2,2-dimethylbutanehydrazide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-(3-methylbutyl)propanamide;4-hydroxy-2,2-dimethylbutanehydrazide |
|---|---|
| PubChem CID | 143678940 |
| Molecular Formula | C18H32N4O5 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-(3-methylbutyl)propanamide;4-hydroxy-2,2-dimethylbutanehydrazide |
| SMILES | CC(C)(CCO)C(=O)NN.CC(C)CCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H18N2O3.C6H14N2O2/c1-9(2)5-7-13-10(15)6-8-14-11(16)3-4-12(14)17;1-6(2,3-4-9)5(10)8-7/h3-4,9H,5-8H2,1-2H3,(H,13,15);9H,3-4,7H2,1-2H3,(H,8,10) |
| InChIKey | BLZLMOHISLHZKY-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|