C16H25N3O4 — CID 70965533
6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2-propylhexanamide (PubChem CID 70965533) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is 6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2-propylhexanamide.
| Compound Name | 6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2-propylhexanamide |
|---|---|
| PubChem CID | 70965533 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2-propylhexanamide |
| SMILES | CCCC(CCCCNC(=O)CCN1C(=O)C=CC1=O)C(N)=O |
| InChI | InChI=1S/C16H25N3O4/c1-2-5-12(16(17)23)6-3-4-10-18-13(20)9-11-19-14(21)7-8-15(19)22/h7-8,12H,2-6,9-11H2,1H3,(H2,17,23)(H,18,20) |
| InChIKey | XCGRGCTWYIHZIP-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|