C10H16N2O6S — CID 163893072
3-(2,5-dioxopyrrol-1-yl)-N-[3-(trihydroxy-λ4-sulfanyl)propyl]propanamide (PubChem CID 163893072) has the molecular formula C10H16N2O6S and a molecular weight of 292.31 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[3-(trihydroxy-λ4-sulfanyl)propyl]propanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[3-(trihydroxy-λ4-sulfanyl)propyl]propanamide |
|---|---|
| PubChem CID | 163893072 |
| Molecular Formula | C10H16N2O6S |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[3-(trihydroxy-λ4-sulfanyl)propyl]propanamide |
| SMILES | O=C(CCN1C(=O)C=CC1=O)NCCCS(O)(O)O |
| InChI | InChI=1S/C10H16N2O6S/c13-8(11-5-1-7-19(16,17)18)4-6-12-9(14)2-3-10(12)15/h2-3,16-18H,1,4-7H2,(H,11,13) |
| InChIKey | QDGCKFUWBHYISG-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|