C11H14N2O5 — CID 146519750
4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]butanoic acid (PubChem CID 146519750) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is 4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]butanoic acid.
| Compound Name | 4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 146519750 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C11H14N2O5/c14-8(12-6-1-2-11(17)18)5-7-13-9(15)3-4-10(13)16/h3-4H,1-2,5-7H2,(H,12,14)(H,17,18) |
| InChIKey | SUIQBAUIZALWNN-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|