C9H13N3O3 — CID 51341002
N-(2-aminoethyl)-3-(2,5-dioxopyrrol-1-yl)propanamide (PubChem CID 51341002) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-(2,5-dioxopyrrol-1-yl)propanamide.
| Compound Name | N-(2-aminoethyl)-3-(2,5-dioxopyrrol-1-yl)propanamide |
|---|---|
| PubChem CID | 51341002 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | N-(2-aminoethyl)-3-(2,5-dioxopyrrol-1-yl)propanamide |
| SMILES | NCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H13N3O3/c10-4-5-11-7(13)3-6-12-8(14)1-2-9(12)15/h1-2H,3-6,10H2,(H,11,13) |
| InChIKey | LGOKQXDILYRQRS-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|