C13H20N2O3 — CID 118446686
N-(3,3-dimethylbutyl)-3-(2,5-dioxopyrrol-1-yl)propanamide (PubChem CID 118446686) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-3-(2,5-dioxopyrrol-1-yl)propanamide.
| Compound Name | N-(3,3-dimethylbutyl)-3-(2,5-dioxopyrrol-1-yl)propanamide |
|---|---|
| PubChem CID | 118446686 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | N-(3,3-dimethylbutyl)-3-(2,5-dioxopyrrol-1-yl)propanamide |
| SMILES | CC(C)(C)CCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H20N2O3/c1-13(2,3)7-8-14-10(16)6-9-15-11(17)4-5-12(15)18/h4-5H,6-9H2,1-3H3,(H,14,16) |
| InChIKey | SNQLKGFGVYFCCZ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|