C20H34N2O5 — CID 158577719
N-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethyl]-6-(2,5-dioxopyrrol-1-yl)hexanamide (PubChem CID 158577719) has the molecular formula C20H34N2O5 and a molecular weight of 382.50 g/mol. Its IUPAC name is N-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethyl]-6-(2,5-dioxopyrrol-1-yl)hexanamide.
| Compound Name | N-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethyl]-6-(2,5-dioxopyrrol-1-yl)hexanamide |
|---|---|
| PubChem CID | 158577719 |
| Molecular Formula | C20H34N2O5 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | N-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethyl]-6-(2,5-dioxopyrrol-1-yl)hexanamide |
| SMILES | CC(C)(C)CCOCCOCCNC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C20H34N2O5/c1-20(2,3)10-13-26-15-16-27-14-11-21-17(23)7-5-4-6-12-22-18(24)8-9-19(22)25/h8-9H,4-7,10-16H2,1-3H3,(H,21,23) |
| InChIKey | HSWDGUZORGTMHN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|