C26H38N4O9 — CID 11376281
6-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2-hydroxyethoxy]ethoxy]ethyl]hexanamide (PubChem CID 11376281) has the molecular formula C26H38N4O9 and a molecular weight of 550.61 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2-hydroxyethoxy]ethoxy]ethyl]hexanamide.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2-hydroxyethoxy]ethoxy]ethyl]hexanamide |
|---|---|
| PubChem CID | 11376281 |
| Molecular Formula | C26H38N4O9 |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2-hydroxyethoxy]ethoxy]ethyl]hexanamide |
| SMILES | O=C(CCCCCN1C(=O)C=CC1=O)NCCOCCOCC(O)NC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C26H38N4O9/c31-20(7-3-1-5-14-29-23(34)9-10-24(29)35)27-13-16-38-17-18-39-19-22(33)28-21(32)8-4-2-6-15-30-25(36)11-12-26(30)37/h9-12,22,33H,1-8,13-19H2,(H,27,31)(H,28,32) |
| InChIKey | ZZQDERMCVKEXCL-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 171.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|