C12H17N5O4 — CID 156598819
N-[2-(2-azidoethoxy)ethyl]-4-(2,5-dioxopyrrol-1-yl)butanamide (PubChem CID 156598819) has the molecular formula C12H17N5O4 and a molecular weight of 295.30 g/mol. Its IUPAC name is N-[2-(2-azidoethoxy)ethyl]-4-(2,5-dioxopyrrol-1-yl)butanamide.
| Compound Name | N-[2-(2-azidoethoxy)ethyl]-4-(2,5-dioxopyrrol-1-yl)butanamide |
|---|---|
| PubChem CID | 156598819 |
| Molecular Formula | C12H17N5O4 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | N-[2-(2-azidoethoxy)ethyl]-4-(2,5-dioxopyrrol-1-yl)butanamide |
| SMILES | [N-]=[N+]=NCCOCCNC(=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H17N5O4/c13-16-15-6-9-21-8-5-14-10(18)2-1-7-17-11(19)3-4-12(17)20/h3-4H,1-2,5-9H2,(H,14,18) |
| InChIKey | UJTIIYYOGYIYIS-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 124.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|