C11H16N2O4S — CID 146614306
N-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethyl]-3-sulfanylpropanamide (PubChem CID 146614306) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is N-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethyl]-3-sulfanylpropanamide.
| Compound Name | N-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 146614306 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | N-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethyl]-3-sulfanylpropanamide |
| SMILES | O=C(CCS)NCCOCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C11H16N2O4S/c14-9(3-8-18)12-4-6-17-7-5-13-10(15)1-2-11(13)16/h1-2,18H,3-8H2,(H,12,14) |
| InChIKey | UCTZPNFEBYQCFA-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|