C28H50N2O11 — CID 121327567
3-[2-[2-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-N-pentylpropanamide (PubChem CID 121327567) has the molecular formula C28H50N2O11 and a molecular weight of 590.71 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-N-pentylpropanamide.
| Compound Name | 3-[2-[2-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-N-pentylpropanamide |
|---|---|
| PubChem CID | 121327567 |
| Molecular Formula | C28H50N2O11 |
| Molecular Weight | 590.71 g/mol |
| Exact Mass | 590.34 |
| IUPAC Name | 3-[2-[2-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-N-pentylpropanamide |
| SMILES | CCCCCNC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C28H50N2O11/c1-2-3-4-8-29-26(31)7-10-34-12-14-36-16-18-38-20-22-40-24-25-41-23-21-39-19-17-37-15-13-35-11-9-30-27(32)5-6-28(30)33/h5-6H,2-4,7-25H2,1H3,(H,29,31) |
| InChIKey | MYFRILNBGLKFCA-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 140.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.71 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|