C18H30N2O6S — CID 134416223
N-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethyl]-5-methylsulfanylpentanamide (PubChem CID 134416223) has the molecular formula C18H30N2O6S and a molecular weight of 402.51 g/mol. Its IUPAC name is N-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethyl]-5-methylsulfanylpentanamide.
| Compound Name | N-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethyl]-5-methylsulfanylpentanamide |
|---|---|
| PubChem CID | 134416223 |
| Molecular Formula | C18H30N2O6S |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | N-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethyl]-5-methylsulfanylpentanamide |
| SMILES | CSCCCCC(=O)NCCOCCOCCOCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C18H30N2O6S/c1-27-15-3-2-4-16(21)19-7-9-24-11-13-26-14-12-25-10-8-20-17(22)5-6-18(20)23/h5-6H,2-4,7-15H2,1H3,(H,19,21) |
| InChIKey | OOSBZFLZQADUOG-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|