C17H27N3O5 — CID 58701502
3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-(2-pyrrolidin-1-ylethoxy)ethoxy]ethyl]propanamide (PubChem CID 58701502) has the molecular formula C17H27N3O5 and a molecular weight of 353.42 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-(2-pyrrolidin-1-ylethoxy)ethoxy]ethyl]propanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-(2-pyrrolidin-1-ylethoxy)ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 58701502 |
| Molecular Formula | C17H27N3O5 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-(2-pyrrolidin-1-ylethoxy)ethoxy]ethyl]propanamide |
| SMILES | O=C(CCN1C(=O)C=CC1=O)NCCOCCOCCN1CCCC1 |
| InChI | InChI=1S/C17H27N3O5/c21-15(5-9-20-16(22)3-4-17(20)23)18-6-11-24-13-14-25-12-10-19-7-1-2-8-19/h3-4H,1-2,5-14H2,(H,18,21) |
| InChIKey | HKUNUYXZKLVQJQ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|