C15H24N2O7 — CID 145117606
3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-(3-oxobutylperoxy)ethoxy]ethyl]propanamide;molecular hydrogen (PubChem CID 145117606) has the molecular formula C15H24N2O7 and a molecular weight of 344.36 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-(3-oxobutylperoxy)ethoxy]ethyl]propanamide;molecular hydrogen.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-(3-oxobutylperoxy)ethoxy]ethyl]propanamide;molecular hydrogen |
|---|---|
| PubChem CID | 145117606 |
| Molecular Formula | C15H24N2O7 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-(3-oxobutylperoxy)ethoxy]ethyl]propanamide;molecular hydrogen |
| SMILES | CC(=O)CCOOCCOCCNC(=O)CCN1C(=O)C=CC1=O.[H][H] |
| InChI | InChI=1S/C15H22N2O7.H2/c1-12(18)5-8-23-24-11-10-22-9-6-16-13(19)4-7-17-14(20)2-3-15(17)21;/h2-3H,4-11H2,1H3,(H,16,19);1H |
| InChIKey | VDZCFHSSQRFZEF-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|