C19H33N3O7 — CID 90742825
3-hydroxy-N-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]propanamide;1-(4-oxopentyl)pyrrole-2,5-dione (PubChem CID 90742825) has the molecular formula C19H33N3O7 and a molecular weight of 415.49 g/mol. Its IUPAC name is 3-hydroxy-N-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]propanamide;1-(4-oxopentyl)pyrrole-2,5-dione.
| Compound Name | 3-hydroxy-N-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]propanamide;1-(4-oxopentyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 90742825 |
| Molecular Formula | C19H33N3O7 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 3-hydroxy-N-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]propanamide;1-(4-oxopentyl)pyrrole-2,5-dione |
| SMILES | CC(=O)CCCN1C(=O)C=CC1=O.CNCCOCCOCCNC(=O)CCO |
| InChI | InChI=1S/C10H22N2O4.C9H11NO3/c1-11-3-6-15-8-9-16-7-4-12-10(14)2-5-13;1-7(11)3-2-6-10-8(12)4-5-9(10)13/h11,13H,2-9H2,1H3,(H,12,14);4-5H,2-3,6H2,1H3 |
| InChIKey | OHNTVLYWAZEIGC-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|