C20H41NO3 — CID 176614152
N-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethyl]-7,7-dimethyloctanamide (PubChem CID 176614152) has the molecular formula C20H41NO3 and a molecular weight of 343.55 g/mol. Its IUPAC name is N-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethyl]-7,7-dimethyloctanamide.
| Compound Name | N-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethyl]-7,7-dimethyloctanamide |
|---|---|
| PubChem CID | 176614152 |
| Molecular Formula | C20H41NO3 |
| Molecular Weight | 343.55 g/mol |
| Exact Mass | 343.31 |
| IUPAC Name | N-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethyl]-7,7-dimethyloctanamide |
| SMILES | CC(C)(C)CCCCCC(=O)NCCOCCOCCC(C)(C)C |
| InChI | InChI=1S/C20H41NO3/c1-19(2,3)11-9-7-8-10-18(22)21-13-15-24-17-16-23-14-12-20(4,5)6/h7-17H2,1-6H3,(H,21,22) |
| InChIKey | LPURQZOONWCJIK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|