C17H35NO — CID 155613162
N-(5,5-dimethylhexyl)-6,6-dimethylheptanamide (PubChem CID 155613162) has the molecular formula C17H35NO and a molecular weight of 269.47 g/mol. Its IUPAC name is N-(5,5-dimethylhexyl)-6,6-dimethylheptanamide.
| Compound Name | N-(5,5-dimethylhexyl)-6,6-dimethylheptanamide |
|---|---|
| PubChem CID | 155613162 |
| Molecular Formula | C17H35NO |
| Molecular Weight | 269.47 g/mol |
| Exact Mass | 269.27 |
| IUPAC Name | N-(5,5-dimethylhexyl)-6,6-dimethylheptanamide |
| SMILES | CC(C)(C)CCCCNC(=O)CCCCC(C)(C)C |
| InChI | InChI=1S/C17H35NO/c1-16(2,3)12-8-7-11-15(19)18-14-10-9-13-17(4,5)6/h7-14H2,1-6H3,(H,18,19) |
| InChIKey | FLOWYXFKPXJQLP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|