C20H39NO2 — CID 165080443
N-(3,3-dimethylbutyl)-11,11-dimethyl-4-oxododecanamide (PubChem CID 165080443) has the molecular formula C20H39NO2 and a molecular weight of 325.54 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-11,11-dimethyl-4-oxododecanamide.
| Compound Name | N-(3,3-dimethylbutyl)-11,11-dimethyl-4-oxododecanamide |
|---|---|
| PubChem CID | 165080443 |
| Molecular Formula | C20H39NO2 |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.30 |
| IUPAC Name | N-(3,3-dimethylbutyl)-11,11-dimethyl-4-oxododecanamide |
| SMILES | CC(C)(C)CCCCCCC(=O)CCC(=O)NCCC(C)(C)C |
| InChI | InChI=1S/C20H39NO2/c1-19(2,3)14-10-8-7-9-11-17(22)12-13-18(23)21-16-15-20(4,5)6/h7-16H2,1-6H3,(H,21,23) |
| InChIKey | MSIZTGXCKJXWSY-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|