C19H37NO2S2 — CID 159781193
N-(3,3-dimethylbutyl)-3-[(7,7-dimethyl-3-oxooctyl)disulfanyl]propanamide (PubChem CID 159781193) has the molecular formula C19H37NO2S2 and a molecular weight of 375.64 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-3-[(7,7-dimethyl-3-oxooctyl)disulfanyl]propanamide.
| Compound Name | N-(3,3-dimethylbutyl)-3-[(7,7-dimethyl-3-oxooctyl)disulfanyl]propanamide |
|---|---|
| PubChem CID | 159781193 |
| Molecular Formula | C19H37NO2S2 |
| Molecular Weight | 375.64 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | N-(3,3-dimethylbutyl)-3-[(7,7-dimethyl-3-oxooctyl)disulfanyl]propanamide |
| SMILES | CC(C)(C)CCCC(=O)CCSSCCC(=O)NCCC(C)(C)C |
| InChI | InChI=1S/C19H37NO2S2/c1-18(2,3)11-7-8-16(21)9-14-23-24-15-10-17(22)20-13-12-19(4,5)6/h7-15H2,1-6H3,(H,20,22) |
| InChIKey | FNXNTXYKIMCBLA-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.64 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|