C13H27NOS2 — CID 88559041
N-[2-(tert-butyldisulfanyl)ethyl]-4,4-dimethylpentanamide (PubChem CID 88559041) has the molecular formula C13H27NOS2 and a molecular weight of 277.50 g/mol. Its IUPAC name is N-[2-(tert-butyldisulfanyl)ethyl]-4,4-dimethylpentanamide.
| Compound Name | N-[2-(tert-butyldisulfanyl)ethyl]-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 88559041 |
| Molecular Formula | C13H27NOS2 |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | N-[2-(tert-butyldisulfanyl)ethyl]-4,4-dimethylpentanamide |
| SMILES | CC(C)(C)CCC(=O)NCCSSC(C)(C)C |
| InChI | InChI=1S/C13H27NOS2/c1-12(2,3)8-7-11(15)14-9-10-16-17-13(4,5)6/h7-10H2,1-6H3,(H,14,15) |
| InChIKey | AHFPZNZOEMBPSX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|