C14H29NO2 — CID 130469220
N-(3-ethyl-3-hydroxypentyl)-4,4-dimethylpentanamide (PubChem CID 130469220) has the molecular formula C14H29NO2 and a molecular weight of 243.39 g/mol. Its IUPAC name is N-(3-ethyl-3-hydroxypentyl)-4,4-dimethylpentanamide.
| Compound Name | N-(3-ethyl-3-hydroxypentyl)-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 130469220 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | N-(3-ethyl-3-hydroxypentyl)-4,4-dimethylpentanamide |
| SMILES | CCC(O)(CC)CCNC(=O)CCC(C)(C)C |
| InChI | InChI=1S/C14H29NO2/c1-6-14(17,7-2)10-11-15-12(16)8-9-13(3,4)5/h17H,6-11H2,1-5H3,(H,15,16) |
| InChIKey | LPUAYRDDWYFYSE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |