C19H38N2O3S — CID 134167212
N-[2-[2-[3-(2,2-dimethylpropylsulfanyl)propanoylamino]ethoxy]ethyl]-4,4-dimethylpentanamide (PubChem CID 134167212) has the molecular formula C19H38N2O3S and a molecular weight of 374.59 g/mol. Its IUPAC name is N-[2-[2-[3-(2,2-dimethylpropylsulfanyl)propanoylamino]ethoxy]ethyl]-4,4-dimethylpentanamide.
| Compound Name | N-[2-[2-[3-(2,2-dimethylpropylsulfanyl)propanoylamino]ethoxy]ethyl]-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 134167212 |
| Molecular Formula | C19H38N2O3S |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | N-[2-[2-[3-(2,2-dimethylpropylsulfanyl)propanoylamino]ethoxy]ethyl]-4,4-dimethylpentanamide |
| SMILES | CC(C)(C)CCC(=O)NCCOCCNC(=O)CCSCC(C)(C)C |
| InChI | InChI=1S/C19H38N2O3S/c1-18(2,3)9-7-16(22)20-10-12-24-13-11-21-17(23)8-14-25-15-19(4,5)6/h7-15H2,1-6H3,(H,20,22)(H,21,23) |
| InChIKey | YQVVBXFEENTIIO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|