C16H34N2OS — CID 139446931
N-[2-(3,3-dimethylbutylamino)ethyl]-3-(2,2-dimethylpropylsulfanyl)propanamide (PubChem CID 139446931) has the molecular formula C16H34N2OS and a molecular weight of 302.53 g/mol. Its IUPAC name is N-[2-(3,3-dimethylbutylamino)ethyl]-3-(2,2-dimethylpropylsulfanyl)propanamide.
| Compound Name | N-[2-(3,3-dimethylbutylamino)ethyl]-3-(2,2-dimethylpropylsulfanyl)propanamide |
|---|---|
| PubChem CID | 139446931 |
| Molecular Formula | C16H34N2OS |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | N-[2-(3,3-dimethylbutylamino)ethyl]-3-(2,2-dimethylpropylsulfanyl)propanamide |
| SMILES | CC(C)(C)CCNCCNC(=O)CCSCC(C)(C)C |
| InChI | InChI=1S/C16H34N2OS/c1-15(2,3)8-9-17-10-11-18-14(19)7-12-20-13-16(4,5)6/h17H,7-13H2,1-6H3,(H,18,19) |
| InChIKey | KQJZAQUBTLNLCA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|