C12H27ClN2O — CID 119509534
N-[2-(ethylamino)ethyl]-5,5-dimethylhexanamide;hydrochloride (PubChem CID 119509534) has the molecular formula C12H27ClN2O and a molecular weight of 250.81 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-5,5-dimethylhexanamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-5,5-dimethylhexanamide;hydrochloride |
|---|---|
| PubChem CID | 119509534 |
| Molecular Formula | C12H27ClN2O |
| Molecular Weight | 250.81 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-5,5-dimethylhexanamide;hydrochloride |
| SMILES | CCNCCNC(=O)CCCC(C)(C)C.Cl |
| InChI | InChI=1S/C12H26N2O.ClH/c1-5-13-9-10-14-11(15)7-6-8-12(2,3)4;/h13H,5-10H2,1-4H3,(H,14,15);1H |
| InChIKey | FGALQFZTANRDCQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.81 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|