C17H35NO — CID 19922141
N-butyl-10,10-dimethylundecanamide (PubChem CID 19922141) has the molecular formula C17H35NO and a molecular weight of 269.47 g/mol. Its IUPAC name is N-butyl-10,10-dimethylundecanamide.
| Compound Name | N-butyl-10,10-dimethylundecanamide |
|---|---|
| PubChem CID | 19922141 |
| Molecular Formula | C17H35NO |
| Molecular Weight | 269.47 g/mol |
| Exact Mass | 269.27 |
| IUPAC Name | N-butyl-10,10-dimethylundecanamide |
| SMILES | CCCCNC(=O)CCCCCCCCC(C)(C)C |
| InChI | InChI=1S/C17H35NO/c1-5-6-15-18-16(19)13-11-9-7-8-10-12-14-17(2,3)4/h5-15H2,1-4H3,(H,18,19) |
| InChIKey | ZFJHRJKDHULBAJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.47 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|