C20H41NO — CID 139961894
N-decyl-7,7-dimethyloctanamide (PubChem CID 139961894) has the molecular formula C20H41NO and a molecular weight of 311.55 g/mol. Its IUPAC name is N-decyl-7,7-dimethyloctanamide.
| Compound Name | N-decyl-7,7-dimethyloctanamide |
|---|---|
| PubChem CID | 139961894 |
| Molecular Formula | C20H41NO |
| Molecular Weight | 311.55 g/mol |
| Exact Mass | 311.32 |
| IUPAC Name | N-decyl-7,7-dimethyloctanamide |
| SMILES | CCCCCCCCCCNC(=O)CCCCCC(C)(C)C |
| InChI | InChI=1S/C20H41NO/c1-5-6-7-8-9-10-11-15-18-21-19(22)16-13-12-14-17-20(2,3)4/h5-18H2,1-4H3,(H,21,22) |
| InChIKey | XPCKOETXNAROFL-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.55 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|