C21H42N2O2 — CID 167085333
N'-(7,7-dimethyloctyl)-N-methyldecanediamide (PubChem CID 167085333) has the molecular formula C21H42N2O2 and a molecular weight of 354.58 g/mol. Its IUPAC name is N'-(7,7-dimethyloctyl)-N-methyldecanediamide.
| Compound Name | N'-(7,7-dimethyloctyl)-N-methyldecanediamide |
|---|---|
| PubChem CID | 167085333 |
| Molecular Formula | C21H42N2O2 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.32 |
| IUPAC Name | N'-(7,7-dimethyloctyl)-N-methyldecanediamide |
| SMILES | CNC(=O)CCCCCCCCC(=O)NCCCCCCC(C)(C)C |
| InChI | InChI=1S/C21H42N2O2/c1-21(2,3)17-13-9-10-14-18-23-20(25)16-12-8-6-5-7-11-15-19(24)22-4/h5-18H2,1-4H3,(H,22,24)(H,23,25) |
| InChIKey | PWUNTRCLQXBQRM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|