About 6-amino-N-[6-(methylamino)-6-oxohexyl]hexanamide;methanamine
6-amino-N-[6-(methylamino)-6-oxohexyl]hexanamide;methanamine (PubChem CID 169247906) has the molecular formula C14H32N4O2
and a molecular weight of 288.44 g/mol. Its IUPAC name is 6-amino-N-[6-(methylamino)-6-oxohexyl]hexanamide;methanamine.
Molecular Properties
| Compound Name | 6-amino-N-[6-(methylamino)-6-oxohexyl]hexanamide;methanamine |
| PubChem CID | 169247906 |
| Molecular Formula | C14H32N4O2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 6-amino-N-[6-(methylamino)-6-oxohexyl]hexanamide;methanamine |
| SMILES | CN.CNC(=O)CCCCCNC(=O)CCCCCN |
| InChI | InChI=1S/C13H27N3O2.CH5N/c1-15-12(17)8-5-3-7-11-16-13(18)9-4-2-6-10-14;1-2/h2-11,14H2,1H3,(H,15,17)(H,16,18);2H2,1H3 |
| InChIKey | MOGIJZLLGQABOH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-N-[6-(methylamino)-6-oxohexyl]hexanamide;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-N-[6-(methylamino)-6-oxohexyl]hexanamide;methanamine?
The IUPAC name of 6-amino-N-[6-(methylamino)-6-oxohexyl]hexanamide;methanamine (CID 169247906) is 6-amino-N-[6-(methylamino)-6-oxohexyl]hexanamide;methanamine.
What is the SMILES notation for 6-amino-N-[6-(methylamino)-6-oxohexyl]hexanamide;methanamine?
The canonical SMILES for 6-amino-N-[6-(methylamino)-6-oxohexyl]hexanamide;methanamine is CN.CNC(=O)CCCCCNC(=O)CCCCCN.
What is the InChIKey of 6-amino-N-[6-(methylamino)-6-oxohexyl]hexanamide;methanamine?
The InChIKey is MOGIJZLLGQABOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3O2.CH5N/c1-15-12(17)8-5-3-7-11-16-13(18)9-4-2-6-10-14;1-2/h2-11,14H2,1H3,(H,15,17)(H,16,18);2H2,1H3.
What are the key properties of 6-amino-N-[6-(methylamino)-6-oxohexyl]hexanamide;methanamine?
6-amino-N-[6-(methylamino)-6-oxohexyl]hexanamide;methanamine has a molecular weight of 288.44 g/mol, XLogP of 0.50, 11 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-N-[6-(methylamino)-6-oxohexyl]hexanamide;methanamine is sourced from PubChem (CID 169247906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).