C18H38N2O4 — CID 138402047
1-aminopropan-2-ol;6-(6,6-dimethylheptanoylamino)hexanoic acid (PubChem CID 138402047) has the molecular formula C18H38N2O4 and a molecular weight of 346.51 g/mol. Its IUPAC name is 1-aminopropan-2-ol;6-(6,6-dimethylheptanoylamino)hexanoic acid.
| Compound Name | 1-aminopropan-2-ol;6-(6,6-dimethylheptanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 138402047 |
| Molecular Formula | C18H38N2O4 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.28 |
| IUPAC Name | 1-aminopropan-2-ol;6-(6,6-dimethylheptanoylamino)hexanoic acid |
| SMILES | CC(C)(C)CCCCC(=O)NCCCCCC(=O)O.CC(O)CN |
| InChI | InChI=1S/C15H29NO3.C3H9NO/c1-15(2,3)11-7-6-9-13(17)16-12-8-4-5-10-14(18)19;1-3(5)2-4/h4-12H2,1-3H3,(H,16,17)(H,18,19);3,5H,2,4H2,1H3 |
| InChIKey | BDXYWGWRSQNDOG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|