C24H44N2O6 — CID 139798563
9-[6-(8-carboxyoctanoylamino)hexylamino]-9-oxononanoic acid (PubChem CID 139798563) has the molecular formula C24H44N2O6 and a molecular weight of 456.62 g/mol. Its IUPAC name is 9-[6-(8-carboxyoctanoylamino)hexylamino]-9-oxononanoic acid.
| Compound Name | 9-[6-(8-carboxyoctanoylamino)hexylamino]-9-oxononanoic acid |
|---|---|
| PubChem CID | 139798563 |
| Molecular Formula | C24H44N2O6 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.32 |
| IUPAC Name | 9-[6-(8-carboxyoctanoylamino)hexylamino]-9-oxononanoic acid |
| SMILES | O=C(O)CCCCCCCC(=O)NCCCCCCNC(=O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C24H44N2O6/c27-21(15-9-3-1-5-11-17-23(29)30)25-19-13-7-8-14-20-26-22(28)16-10-4-2-6-12-18-24(31)32/h1-20H2,(H,25,27)(H,26,28)(H,29,30)(H,31,32) |
| InChIKey | SZMUMFHRWNBWGA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|