C18H38N4O6 — CID 170853910
azane;6-[6-(5-carboxypentanoylamino)hexylamino]-6-oxohexanoic acid (PubChem CID 170853910) has the molecular formula C18H38N4O6 and a molecular weight of 406.52 g/mol. Its IUPAC name is azane;6-[6-(5-carboxypentanoylamino)hexylamino]-6-oxohexanoic acid.
| Compound Name | azane;6-[6-(5-carboxypentanoylamino)hexylamino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 170853910 |
| Molecular Formula | C18H38N4O6 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.28 |
| IUPAC Name | azane;6-[6-(5-carboxypentanoylamino)hexylamino]-6-oxohexanoic acid |
| SMILES | N.N.O=C(O)CCCCC(=O)NCCCCCCNC(=O)CCCCC(=O)O |
| InChI | InChI=1S/C18H32N2O6.2H3N/c21-15(9-3-5-11-17(23)24)19-13-7-1-2-8-14-20-16(22)10-4-6-12-18(25)26;;/h1-14H2,(H,19,21)(H,20,22)(H,23,24)(H,25,26);2*1H3 |
| InChIKey | GAQUHYKNDAAIPA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 202.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|