C17H34INO — CID 155298915
N-(5,5-dimethylhexyl)-7-iodo-7-methyloctanamide (PubChem CID 155298915) has the molecular formula C17H34INO and a molecular weight of 395.37 g/mol. Its IUPAC name is N-(5,5-dimethylhexyl)-7-iodo-7-methyloctanamide.
| Compound Name | N-(5,5-dimethylhexyl)-7-iodo-7-methyloctanamide |
|---|---|
| PubChem CID | 155298915 |
| Molecular Formula | C17H34INO |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | N-(5,5-dimethylhexyl)-7-iodo-7-methyloctanamide |
| SMILES | CC(C)(C)CCCCNC(=O)CCCCCC(C)(C)I |
| InChI | InChI=1S/C17H34INO/c1-16(2,3)12-9-10-14-19-15(20)11-7-6-8-13-17(4,5)18/h6-14H2,1-5H3,(H,19,20) |
| InChIKey | PIXHRNXHFSXUGE-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|