C19H39NO3 — CID 91426047
8-hydroxy-N-(7-hydroxy-6,6-dimethylheptyl)-7,7-dimethyloctanamide (PubChem CID 91426047) has the molecular formula C19H39NO3 and a molecular weight of 329.53 g/mol. Its IUPAC name is 8-hydroxy-N-(7-hydroxy-6,6-dimethylheptyl)-7,7-dimethyloctanamide.
| Compound Name | 8-hydroxy-N-(7-hydroxy-6,6-dimethylheptyl)-7,7-dimethyloctanamide |
|---|---|
| PubChem CID | 91426047 |
| Molecular Formula | C19H39NO3 |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.29 |
| IUPAC Name | 8-hydroxy-N-(7-hydroxy-6,6-dimethylheptyl)-7,7-dimethyloctanamide |
| SMILES | CC(C)(CO)CCCCCNC(=O)CCCCCC(C)(C)CO |
| InChI | InChI=1S/C19H39NO3/c1-18(2,15-21)12-8-5-7-11-17(23)20-14-10-6-9-13-19(3,4)16-22/h21-22H,5-16H2,1-4H3,(H,20,23) |
| InChIKey | NCFZZLDRVDHYMU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|