C10H22ClN3O2 — CID 119508003
N-[2-[2-(ethylamino)ethylamino]-2-oxoethyl]butanamide;hydrochloride (PubChem CID 119508003) has the molecular formula C10H22ClN3O2 and a molecular weight of 251.76 g/mol. Its IUPAC name is N-[2-[2-(ethylamino)ethylamino]-2-oxoethyl]butanamide;hydrochloride.
| Compound Name | N-[2-[2-(ethylamino)ethylamino]-2-oxoethyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119508003 |
| Molecular Formula | C10H22ClN3O2 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | N-[2-[2-(ethylamino)ethylamino]-2-oxoethyl]butanamide;hydrochloride |
| SMILES | CCCC(=O)NCC(=O)NCCNCC.Cl |
| InChI | InChI=1S/C10H21N3O2.ClH/c1-3-5-9(14)13-8-10(15)12-7-6-11-4-2;/h11H,3-8H2,1-2H3,(H,12,15)(H,13,14);1H |
| InChIKey | RNLWJDGAVDQNPI-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|