C13H31NO2 — CID 166490079
ethane;N-(3-hydroxypropyl)-5,5-dimethylhexanamide;molecular hydrogen (PubChem CID 166490079) has the molecular formula C13H31NO2 and a molecular weight of 233.40 g/mol. Its IUPAC name is ethane;N-(3-hydroxypropyl)-5,5-dimethylhexanamide;molecular hydrogen.
| Compound Name | ethane;N-(3-hydroxypropyl)-5,5-dimethylhexanamide;molecular hydrogen |
|---|---|
| PubChem CID | 166490079 |
| Molecular Formula | C13H31NO2 |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.24 |
| IUPAC Name | ethane;N-(3-hydroxypropyl)-5,5-dimethylhexanamide;molecular hydrogen |
| SMILES | CC.CC(C)(C)CCCC(=O)NCCCO.[H][H] |
| InChI | InChI=1S/C11H23NO2.C2H6.H2/c1-11(2,3)7-4-6-10(14)12-8-5-9-13;1-2;/h13H,4-9H2,1-3H3,(H,12,14);1-2H3;1H |
| InChIKey | PLMZEYPAIPPTMH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|