C18H36N2O3S — CID 57211881
5-[2-[3-(3,3-dimethylbutylamino)propanoylamino]ethylsulfanyl]-3,3-dimethylpentanoic acid (PubChem CID 57211881) has the molecular formula C18H36N2O3S and a molecular weight of 360.56 g/mol. Its IUPAC name is 5-[2-[3-(3,3-dimethylbutylamino)propanoylamino]ethylsulfanyl]-3,3-dimethylpentanoic acid.
| Compound Name | 5-[2-[3-(3,3-dimethylbutylamino)propanoylamino]ethylsulfanyl]-3,3-dimethylpentanoic acid |
|---|---|
| PubChem CID | 57211881 |
| Molecular Formula | C18H36N2O3S |
| Molecular Weight | 360.56 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | 5-[2-[3-(3,3-dimethylbutylamino)propanoylamino]ethylsulfanyl]-3,3-dimethylpentanoic acid |
| SMILES | CC(C)(C)CCNCCC(=O)NCCSCCC(C)(C)CC(=O)O |
| InChI | InChI=1S/C18H36N2O3S/c1-17(2,3)7-10-19-9-6-15(21)20-11-13-24-12-8-18(4,5)14-16(22)23/h19H,6-14H2,1-5H3,(H,20,21)(H,22,23) |
| InChIKey | NENKZOFAYUFQQX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.56 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|