6-[3-(ethylamino)propanoylamino]-4,4-dimethylhexanoic acid

C13H26N2O3 — CID 65286127

IUPAC6-[3-(ethylamino)propanoylamino]-4,4-dimethylhexanoic acid
SMILESCCNCCC(=O)NCCC(C)(C)CCC(=O)O
InChIInChI=1S/C13H26N2O3/c1-4-14-9-6-11(16)15-10-8-13(2,3)7-5-12(17)18/h14H,4-10H2,1-3H3,(H,15,16)(H,17,18)
InChIKeyUIBRPAMCEKOVFO-UHFFFAOYSA-N
MW258.36 g/mol
LogP1.38
Rot. Bonds10

About 6-[3-(ethylamino)propanoylamino]-4,4-dimethylhexanoic acid

6-[3-(ethylamino)propanoylamino]-4,4-dimethylhexanoic acid (PubChem CID 65286127) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is 6-[3-(ethylamino)propanoylamino]-4,4-dimethylhexanoic acid.

Molecular Properties

Compound Name6-[3-(ethylamino)propanoylamino]-4,4-dimethylhexanoic acid
PubChem CID65286127
Molecular FormulaC13H26N2O3
Molecular Weight258.36 g/mol
Exact Mass258.19
IUPAC Name6-[3-(ethylamino)propanoylamino]-4,4-dimethylhexanoic acid
SMILESCCNCCC(=O)NCCC(C)(C)CCC(=O)O
InChIInChI=1S/C13H26N2O3/c1-4-14-9-6-11(16)15-10-8-13(2,3)7-5-12(17)18/h14H,4-10H2,1-3H3,(H,15,16)(H,17,18)
InChIKeyUIBRPAMCEKOVFO-UHFFFAOYSA-N
XLogP1.38
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds10
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.36
LogP ≤ 51.38
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 6-[3-(ethylamino)propanoylamino]-4,4-dimethylhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-[3-(ethylamino)propanoylamino]-4,4-dimethylhexanoic acid?
The IUPAC name of 6-[3-(ethylamino)propanoylamino]-4,4-dimethylhexanoic acid (CID 65286127) is 6-[3-(ethylamino)propanoylamino]-4,4-dimethylhexanoic acid.
What is the SMILES notation for 6-[3-(ethylamino)propanoylamino]-4,4-dimethylhexanoic acid?
The canonical SMILES for 6-[3-(ethylamino)propanoylamino]-4,4-dimethylhexanoic acid is CCNCCC(=O)NCCC(C)(C)CCC(=O)O.
What is the InChIKey of 6-[3-(ethylamino)propanoylamino]-4,4-dimethylhexanoic acid?
The InChIKey is UIBRPAMCEKOVFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O3/c1-4-14-9-6-11(16)15-10-8-13(2,3)7-5-12(17)18/h14H,4-10H2,1-3H3,(H,15,16)(H,17,18).
What are the key properties of 6-[3-(ethylamino)propanoylamino]-4,4-dimethylhexanoic acid?
6-[3-(ethylamino)propanoylamino]-4,4-dimethylhexanoic acid has a molecular weight of 258.36 g/mol, XLogP of 1.38, 10 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(ethylamino)propanoylamino]-4,4-dimethylhexanoic acid is sourced from PubChem (CID 65286127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).