C16H31NO3 — CID 65284261
4,4-dimethyl-6-(3,4,4-trimethylpentanoylamino)hexanoic acid (PubChem CID 65284261) has the molecular formula C16H31NO3 and a molecular weight of 285.43 g/mol. Its IUPAC name is 4,4-dimethyl-6-(3,4,4-trimethylpentanoylamino)hexanoic acid.
| Compound Name | 4,4-dimethyl-6-(3,4,4-trimethylpentanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 65284261 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | 4,4-dimethyl-6-(3,4,4-trimethylpentanoylamino)hexanoic acid |
| SMILES | CC(CC(=O)NCCC(C)(C)CCC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C16H31NO3/c1-12(15(2,3)4)11-13(18)17-10-9-16(5,6)8-7-14(19)20/h12H,7-11H2,1-6H3,(H,17,18)(H,19,20) |
| InChIKey | HYHVCDQFFOQFAU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |