C14H28N2O3 — CID 79257053
6-[[2-(tert-butylamino)acetyl]amino]-4,4-dimethylhexanoic acid (PubChem CID 79257053) has the molecular formula C14H28N2O3 and a molecular weight of 272.39 g/mol. Its IUPAC name is 6-[[2-(tert-butylamino)acetyl]amino]-4,4-dimethylhexanoic acid.
| Compound Name | 6-[[2-(tert-butylamino)acetyl]amino]-4,4-dimethylhexanoic acid |
|---|---|
| PubChem CID | 79257053 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 6-[[2-(tert-butylamino)acetyl]amino]-4,4-dimethylhexanoic acid |
| SMILES | CC(C)(CCNC(=O)CNC(C)(C)C)CCC(=O)O |
| InChI | InChI=1S/C14H28N2O3/c1-13(2,3)16-10-11(17)15-9-8-14(4,5)7-6-12(18)19/h16H,6-10H2,1-5H3,(H,15,17)(H,18,19) |
| InChIKey | GHMGZRMNAXBQQL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |