C13H28N2O — CID 106122483
N-(4-aminopentyl)-3,4,4-trimethylpentanamide (PubChem CID 106122483) has the molecular formula C13H28N2O and a molecular weight of 228.38 g/mol. Its IUPAC name is N-(4-aminopentyl)-3,4,4-trimethylpentanamide.
| Compound Name | N-(4-aminopentyl)-3,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 106122483 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | N-(4-aminopentyl)-3,4,4-trimethylpentanamide |
| SMILES | CC(N)CCCNC(=O)CC(C)C(C)(C)C |
| InChI | InChI=1S/C13H28N2O/c1-10(13(3,4)5)9-12(16)15-8-6-7-11(2)14/h10-11H,6-9,14H2,1-5H3,(H,15,16) |
| InChIKey | HQTDFQWTZZXZGO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|