C12H22N2O — CID 63832913
N-(3-cyanopropyl)-3,4,4-trimethylpentanamide (PubChem CID 63832913) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is N-(3-cyanopropyl)-3,4,4-trimethylpentanamide.
| Compound Name | N-(3-cyanopropyl)-3,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 63832913 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | N-(3-cyanopropyl)-3,4,4-trimethylpentanamide |
| SMILES | CC(CC(=O)NCCCC#N)C(C)(C)C |
| InChI | InChI=1S/C12H22N2O/c1-10(12(2,3)4)9-11(15)14-8-6-5-7-13/h10H,5-6,8-9H2,1-4H3,(H,14,15) |
| InChIKey | UUGGDXWBLBNDFS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|