C14H28INO — CID 107848081
N-(6-iodohexyl)-3,4,4-trimethylpentanamide (PubChem CID 107848081) has the molecular formula C14H28INO and a molecular weight of 353.29 g/mol. Its IUPAC name is N-(6-iodohexyl)-3,4,4-trimethylpentanamide.
| Compound Name | N-(6-iodohexyl)-3,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 107848081 |
| Molecular Formula | C14H28INO |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-(6-iodohexyl)-3,4,4-trimethylpentanamide |
| SMILES | CC(CC(=O)NCCCCCCI)C(C)(C)C |
| InChI | InChI=1S/C14H28INO/c1-12(14(2,3)4)11-13(17)16-10-8-6-5-7-9-15/h12H,5-11H2,1-4H3,(H,16,17) |
| InChIKey | GCWYWUBOCSAXJI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|