C10H19N3O — CID 82010988
5-amino-N-(3-cyanopropyl)-4-methylpentanamide (PubChem CID 82010988) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 5-amino-N-(3-cyanopropyl)-4-methylpentanamide.
| Compound Name | 5-amino-N-(3-cyanopropyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 82010988 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 5-amino-N-(3-cyanopropyl)-4-methylpentanamide |
| SMILES | CC(CN)CCC(=O)NCCCC#N |
| InChI | InChI=1S/C10H19N3O/c1-9(8-12)4-5-10(14)13-7-3-2-6-11/h9H,2-5,7-8,12H2,1H3,(H,13,14) |
| InChIKey | DQILATUKOGLBPJ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|