C25H47N5O2 — CID 22949703
(E)-N,N'-bis(5-amino-4-methylpentyl)-9-cyanododec-5-enediamide (PubChem CID 22949703) has the molecular formula C25H47N5O2 and a molecular weight of 449.68 g/mol. Its IUPAC name is (E)-N,N'-bis(5-amino-4-methylpentyl)-9-cyanododec-5-enediamide.
| Compound Name | (E)-N,N'-bis(5-amino-4-methylpentyl)-9-cyanododec-5-enediamide |
|---|---|
| PubChem CID | 22949703 |
| Molecular Formula | C25H47N5O2 |
| Molecular Weight | 449.68 g/mol |
| Exact Mass | 449.37 |
| IUPAC Name | (E)-N,N'-bis(5-amino-4-methylpentyl)-9-cyanododec-5-enediamide |
| SMILES | CC(CN)CCCNC(=O)CCC/C=C/CCC(C#N)CCC(=O)NCCCC(C)CN |
| InChI | InChI=1S/C25H47N5O2/c1-21(18-26)10-8-16-29-24(31)13-7-5-3-4-6-12-23(20-28)14-15-25(32)30-17-9-11-22(2)19-27/h3-4,21-23H,5-19,26-27H2,1-2H3,(H,29,31)(H,30,32)/b4-3+ |
| InChIKey | OZLPYHDOVQDRNC-ONEGZZNKSA-N |
| XLogP | 3.40 |
| TPSA | 134.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.68 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|