C13H24N2O — CID 62666428
N-(3-cyanopropyl)-3,5,5-trimethylhexanamide (PubChem CID 62666428) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is N-(3-cyanopropyl)-3,5,5-trimethylhexanamide.
| Compound Name | N-(3-cyanopropyl)-3,5,5-trimethylhexanamide |
|---|---|
| PubChem CID | 62666428 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | N-(3-cyanopropyl)-3,5,5-trimethylhexanamide |
| SMILES | CC(CC(=O)NCCCC#N)CC(C)(C)C |
| InChI | InChI=1S/C13H24N2O/c1-11(10-13(2,3)4)9-12(16)15-8-6-5-7-14/h11H,5-6,8-10H2,1-4H3,(H,15,16) |
| InChIKey | AMPZQFLZPCKHET-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|