C12H24N4O — CID 61344869
N-(3-azidopropyl)-3,5,5-trimethylhexanamide (PubChem CID 61344869) has the molecular formula C12H24N4O and a molecular weight of 240.35 g/mol. Its IUPAC name is N-(3-azidopropyl)-3,5,5-trimethylhexanamide.
| Compound Name | N-(3-azidopropyl)-3,5,5-trimethylhexanamide |
|---|---|
| PubChem CID | 61344869 |
| Molecular Formula | C12H24N4O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | N-(3-azidopropyl)-3,5,5-trimethylhexanamide |
| SMILES | CC(CC(=O)NCCCN=[N+]=[N-])CC(C)(C)C |
| InChI | InChI=1S/C12H24N4O/c1-10(9-12(2,3)4)8-11(17)14-6-5-7-15-16-13/h10H,5-9H2,1-4H3,(H,14,17) |
| InChIKey | RBUJCAJXMJMYQL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|