C13H27NO2 — CID 106843836
N-(4-hydroxybutyl)-3,5,5-trimethylhexanamide (PubChem CID 106843836) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is N-(4-hydroxybutyl)-3,5,5-trimethylhexanamide.
| Compound Name | N-(4-hydroxybutyl)-3,5,5-trimethylhexanamide |
|---|---|
| PubChem CID | 106843836 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | N-(4-hydroxybutyl)-3,5,5-trimethylhexanamide |
| SMILES | CC(CC(=O)NCCCCO)CC(C)(C)C |
| InChI | InChI=1S/C13H27NO2/c1-11(10-13(2,3)4)9-12(16)14-7-5-6-8-15/h11,15H,5-10H2,1-4H3,(H,14,16) |
| InChIKey | ZHADNUKSSUMWGW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|