C14H30N2O2 — CID 113430451
N-[2-(2-hydroxypropylamino)ethyl]-3,5,5-trimethylhexanamide (PubChem CID 113430451) has the molecular formula C14H30N2O2 and a molecular weight of 258.41 g/mol. Its IUPAC name is N-[2-(2-hydroxypropylamino)ethyl]-3,5,5-trimethylhexanamide.
| Compound Name | N-[2-(2-hydroxypropylamino)ethyl]-3,5,5-trimethylhexanamide |
|---|---|
| PubChem CID | 113430451 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | N-[2-(2-hydroxypropylamino)ethyl]-3,5,5-trimethylhexanamide |
| SMILES | CC(O)CNCCNC(=O)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C14H30N2O2/c1-11(9-14(3,4)5)8-13(18)16-7-6-15-10-12(2)17/h11-12,15,17H,6-10H2,1-5H3,(H,16,18) |
| InChIKey | ZGWZFQCPJPMYNU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|