C19H41N3O — CID 129083201
6-(propan-2-ylamino)-N-[2-(2,4,4-trimethylpentylamino)ethyl]hexanamide (PubChem CID 129083201) has the molecular formula C19H41N3O and a molecular weight of 327.56 g/mol. Its IUPAC name is 6-(propan-2-ylamino)-N-[2-(2,4,4-trimethylpentylamino)ethyl]hexanamide.
| Compound Name | 6-(propan-2-ylamino)-N-[2-(2,4,4-trimethylpentylamino)ethyl]hexanamide |
|---|---|
| PubChem CID | 129083201 |
| Molecular Formula | C19H41N3O |
| Molecular Weight | 327.56 g/mol |
| Exact Mass | 327.32 |
| IUPAC Name | 6-(propan-2-ylamino)-N-[2-(2,4,4-trimethylpentylamino)ethyl]hexanamide |
| SMILES | CC(CNCCNC(=O)CCCCCNC(C)C)CC(C)(C)C |
| InChI | InChI=1S/C19H41N3O/c1-16(2)21-11-9-7-8-10-18(23)22-13-12-20-15-17(3)14-19(4,5)6/h16-17,20-21H,7-15H2,1-6H3,(H,22,23) |
| InChIKey | IZXMVWNDWKJEPD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|