C11H24N2O2 — CID 20668910
4-hydroxy-N-[2-(2-methylbutylamino)ethyl]butanamide (PubChem CID 20668910) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 4-hydroxy-N-[2-(2-methylbutylamino)ethyl]butanamide.
| Compound Name | 4-hydroxy-N-[2-(2-methylbutylamino)ethyl]butanamide |
|---|---|
| PubChem CID | 20668910 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 4-hydroxy-N-[2-(2-methylbutylamino)ethyl]butanamide |
| SMILES | CCC(C)CNCCNC(=O)CCCO |
| InChI | InChI=1S/C11H24N2O2/c1-3-10(2)9-12-6-7-13-11(15)5-4-8-14/h10,12,14H,3-9H2,1-2H3,(H,13,15) |
| InChIKey | ODSJOEDBNURTGQ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|